BMMCBZ4Sd003
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=3-(3,5-Diiodo-4-hydroxy-phenyl)-lactic acid | + | |SysName=3- (3,5-Diiodo-4-hydroxy-phenyl) -lactic acid |
− | |Common Name=&&3-(3,5-Diiodo-4-hydroxyphenyl)lactate&& | + | |Common Name=&&3- (3,5-Diiodo-4-hydroxyphenyl) lactate&& |
|CAS=? | |CAS=? | ||
|KEGG=C04367 | |KEGG=C04367 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C04367 |
KNApSAcK | |
CDX file | |
MOL file | BMMCBZ4Sd003.mol |
3- (3,5-Diiodo-4-hydroxyphenyl) lactate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3- (3,5-Diiodo-4-hydroxy-phenyl) -lactic acid |
Common Name |
|
Symbol | |
Formula | C9H8I2O4 |
Exact Mass | 433.8511 |
Average Mass | 433.9669 |
SMILES | OC(=O)C(O)Cc(c1)cc(I)c(O)c(I)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways