BMMCBZ3Sn010
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 51-28-5 |
| KEGG | C02496 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCBZ3Sn010.mol |
| 2,4-Dinitrophenol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2,4-Dinitro-phenol |
| Common Name |
|
| Symbol | |
| Formula | C6H4N2O5 |
| Exact Mass | 184.012 |
| Average Mass | 184.1064 |
| SMILES | Oc(c1)c(cc(c1)[N+1]([O-1])=O)[N+1]([O-1])=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
