BMMCBZ2Pn039
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 100-01-6 |
KEGG | C02126 |
KNApSAcK | |
CDX file | |
MOL file | BMMCBZ2Pn039.mol |
4-Nitroaniline | |
---|---|
Structural Information | |
Systematic Name | 4-Nitro-aniline |
Common Name |
|
Symbol | |
Formula | C6H6N2O2 |
Exact Mass | 138.0429 |
Average Mass | 138.1241 |
SMILES | Nc(c1)ccc(c1)[N+1]([O-1])=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |