BMMCBZ2Pk002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(R)-3-(4-Hydroxy-phenyl)-lactic acid | + | |SysName= (R) -3- (4-Hydroxy-phenyl) -lactic acid |
| − | |Common Name=&&(R)-3-(4-Hydroxyphenyl)lactate&& | + | |Common Name=&& (R) -3- (4-Hydroxyphenyl) lactate&& |
|CAS=89919-57-3 | |CAS=89919-57-3 | ||
|KEGG=C03964 | |KEGG=C03964 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 89919-57-3 |
| KEGG | C03964 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCBZ2Pk002.mol |
| (R) -3- (4-Hydroxyphenyl) lactate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (R) -3- (4-Hydroxy-phenyl) -lactic acid |
| Common Name |
|
| Symbol | |
| Formula | C9H10O4 |
| Exact Mass | 182.0579 |
| Average Mass | 182.1733 |
| SMILES | Oc(c1)ccc(c1)C[C@@H](O)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
