BMMCBZ2Pd006
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-(4'-Chlorophenyl)-3,3-dichloro-propenoic acid | + | |SysName=2- (4'-Chlorophenyl) -3,3-dichloro-propenoic acid |
| − | |Common Name=&&2-(4'-Chlorophenyl)-3,3-dichloropropenoate&& | + | |Common Name=&&2- (4'-Chlorophenyl) -3,3-dichloropropenoate&& |
|CAS=? | |CAS=? | ||
|KEGG=C06646 | |KEGG=C06646 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C06646 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCBZ2Pd006.mol |
| 2- (4'-Chlorophenyl) -3,3-dichloropropenoate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (4'-Chlorophenyl) -3,3-dichloro-propenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C9H7Cl3O2 |
| Exact Mass | 251.9511 |
| Average Mass | 253.5087 |
| SMILES | OC(=O)C(c(c1)ccc(Cl)c1)C(Cl)Cl |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
