BMMCBZ1Sn032
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 874-52-2 |
KEGG | C01183 |
KNApSAcK | |
CDX file | |
MOL file | BMMCBZ1Sn032.mol |
Structural Information | |
---|---|
Systematic Name | N,N-Dimethyl-aniline N-oxide |
Common Name | |
Symbol | |
Formula | C8H11NO |
Exact Mass | 137.084 |
Average Mass | 137.179 |
SMILES | C[N+1](C)([O-1])c(c1)cccc1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |