BMMCAS--d008
From Metabolomics.JP
(Difference between revisions)
| Line 2: | Line 2: | ||
|SysName=3,5,3'-Triiodo-thyro-pyruvic acid | |SysName=3,5,3'-Triiodo-thyro-pyruvic acid | ||
|Common Name=&&3,5,3'-Triiodothyropyruvate&&3-[4-(4-Hydroxy-3-iodophenoxy)-3,5-diiodophenyl]-2-oxopropanoate&& | |Common Name=&&3,5,3'-Triiodothyropyruvate&&3-[4-(4-Hydroxy-3-iodophenoxy)-3,5-diiodophenyl]-2-oxopropanoate&& | ||
| − | |CAS= | + | |CAS=24682-68-6 |
|KEGG=C03832 | |KEGG=C03832 | ||
}} | }} | ||
Revision as of 09:00, 14 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 24682-68-6 |
| KEGG | C03832 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCAS--d008.mol |
| 3,5,3'-Triiodothyropyruvate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,3'-Triiodo-thyro-pyruvic acid |
| Common Name |
|
| Symbol | |
| Formula | C15H9I3O5 |
| Exact Mass | 649.7584 |
| Average Mass | 649.9432 |
| SMILES | OC(=O)C(=O)Cc(c1)cc(I)c(Oc(c2)cc(I)c(O)c2)c(I)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
