BMMCAS--d001
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C06644 |
KNApSAcK | |
CDX file | |
MOL file | BMMCAS--d001.mol |
1,1-Dichloro-2-(dihydroxy-4'-chlorophenyl)-2-(4'- | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 1,1-Dichloro-2-(dihydroxy-4'-chorophenyl)-2-(4'-chlorophenyl)-ethylene |
Common Name |
|
Symbol | |
Formula | C14H8Cl4O2 |
Exact Mass | 347.9278 |
Average Mass | 350.0229 |
SMILES | Clc(c2)ccc(c2)C(=C(Cl)Cl)c(c1)c(O)c(O)c(Cl)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways