BMMCACXXo005
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 69098-42-6 |
KEGG | D00102 |
KNApSAcK | |
CDX file | |
MOL file | BMMCACXXo005.mol |
![]() | |
Structural Information | |
Systematic Name | Iridotrial |
Common Name | |
Symbol | |
Formula | C10H14O3 |
Exact Mass | 182.0942 |
Average Mass | 182.2163 |
SMILES | O=CC(C=O)[C@@H](C1)[C@H](C=O)[C@@H](C)C1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |