BMMCACCHq004
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(+)-trans-Pulegol | + | |SysName= (+) -trans-Pulegol |
− | |Common Name=&&(+)-trans-Pulegol&& | + | |Common Name=&& (+) -trans-Pulegol&& |
|CAS=22472-79-3 | |CAS=22472-79-3 | ||
|KEGG=C02484 | |KEGG=C02484 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 22472-79-3 |
KEGG | C02484 |
KNApSAcK | |
CDX file | |
MOL file | BMMCACCHq004.mol |
(+) -trans-Pulegol | |
---|---|
Structural Information | |
Systematic Name | (+) -trans-Pulegol |
Common Name |
|
Symbol | |
Formula | C10H18O |
Exact Mass | 154.1357 |
Average Mass | 154.2493 |
SMILES | C[C@H](C1)C[C@H](O)C(C1)=C(C)C |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |