BMMCACCHq004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(+)-trans-Pulegol | + | |SysName= (+) -trans-Pulegol |
| − | |Common Name=&&(+)-trans-Pulegol&& | + | |Common Name=&& (+) -trans-Pulegol&& |
|CAS=22472-79-3 | |CAS=22472-79-3 | ||
|KEGG=C02484 | |KEGG=C02484 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 22472-79-3 |
| KEGG | C02484 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCACCHq004.mol |
| (+) -trans-Pulegol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (+) -trans-Pulegol |
| Common Name |
|
| Symbol | |
| Formula | C10H18O |
| Exact Mass | 154.1357 |
| Average Mass | 154.2493 |
| SMILES | C[C@H](C1)C[C@H](O)C(C1)=C(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
