BMMCACCHk005
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(1S,3R,4S)-3,4-Dihydroxy-cyclohexane-1-carboxylic acid | + | |SysName= (1S,3R,4S) -3,4-Dihydroxy-cyclohexane-1-carboxylic acid |
| − | |Common Name=&&(1S,3R,4S)-3,4-Dihydroxycyclohexane-1-carboxylate&& | + | |Common Name=&& (1S,3R,4S) -3,4-Dihydroxycyclohexane-1-carboxylate&& |
|CAS=? | |CAS=? | ||
|KEGG=C04687 | |KEGG=C04687 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C04687 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCACCHk005.mol |
| (1S,3R,4S) -3,4-Dihydroxycyclohexane-1-carboxylate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (1S,3R,4S) -3,4-Dihydroxy-cyclohexane-1-carboxylic acid |
| Common Name |
|
| Symbol | |
| Formula | C7H12O4 |
| Exact Mass | 160.0735 |
| Average Mass | 160.1677 |
| SMILES | OC(=O)[C@@H](C1)C[C@@H](O)[C@@H](O)C1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
