BMFYS6ESa002
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 19774-86-8 |
KEGG | C05269 |
KNApSAcK | |
CDX file | |
MOL file | BMFYS6ESa002.mol |
3-Oxohexanoyl-CoA | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3-Oxo-hexanoyl-CoA |
Common Name |
|
Symbol | |
Formula | C27H44N7O18P3S |
Exact Mass | 879.1676 |
Average Mass | 879.6619 |
SMILES | C([C@H](C(NCCC(NCCSC(CC(CCC)=O)=O)=O)=O)O)(C)(C)CO |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways