BMFYS6CAm002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(3S,5S)-3,5-Diamino-hexanoic acid | + | |SysName= (3S,5S) -3,5-Diamino-hexanoic acid |
| − | |Common Name=&&(3S,5S)-3,5-Diaminohexanoate&&L-erythro-3,5-Diaminohexanoate&&(3S,5S)-3,5-Diaminocaproate&&L-erythro-3,5-Diaminocaproate&& | + | |Common Name=&& (3S,5S) -3,5-Diaminohexanoate&&L-erythro-3,5-Diaminohexanoate&& (3S,5S) -3,5-Diaminocaproate&&L-erythro-3,5-Diaminocaproate&& |
|CAS=34281-55-5 | |CAS=34281-55-5 | ||
|KEGG=C01186 | |KEGG=C01186 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 34281-55-5 |
| KEGG | C01186 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMFYS6CAm002.mol |
| (3S,5S) -3,5-Diaminohexanoate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (3S,5S) -3,5-Diamino-hexanoic acid |
| Common Name |
|
| Symbol | |
| Formula | C6H14N2O2 |
| Exact Mass | 146.1055 |
| Average Mass | 146.1876 |
| SMILES | C[C@H](N)C[C@H](N)CC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
