BMFYS5CAm015
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C03943 |
KNApSAcK | |
CDX file | |
MOL file | BMFYS5CAm015.mol |
(2R,4S)-2,4-Diaminopentanoate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | D-threo-2,4-Diamino-pentanoic acid |
Common Name |
|
Symbol | |
Formula | C5H12N2O2 |
Exact Mass | 132.0898 |
Average Mass | 132.161 |
SMILES | C[C@@H](N)C[C@@H](N)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways