BMFYS3CAe018
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 3443-58-1 |
| KEGG | C00197 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMFYS3CAe018.mol |
| |
| Structural Information | |
| Systematic Name | D-Glycerate 3-phosphate |
| Common Name | |
| Symbol | |
| Formula | C3H7O7P |
| Exact Mass | 185.9929 |
| Average Mass | 186.0572 |
| SMILES | O[C@H](COP(O)(O)=O)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
- 2,3-Bisphospho-D-glyceric acid ⇔ this
- (2R) -3-Hydroxy-2-phosphonooxypropanoic acid ⇔ this
- this ⇔ 3-Phospho-hydroxy-pyruvic acid
- this ⇔ 1,3-Bisphospho-D-glyceric acid (2nd)
- 2,3-Dihydroxypropanoic acid ⇔ this
- 1,3-Bisphospho-D-glyceric acid ⇔ this
- D-Ribulose 1,5-bisphosphate ⇔ this
- D-Ribulose 1,5-bisphosphate ⇔ this (2nd)
- CO2 ⇔ this
