BMFYB7DAj004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=N-Succinyl-2-amino-6-oxo-L-pimelic acid | |SysName=N-Succinyl-2-amino-6-oxo-L-pimelic acid | ||
| − | |Common Name=&&N-Succinyl-2-L-amino-6-oxoheptanedioate&&N-Succinyl-L-2-amino-6-oxoheptanedioate&&N-Succinyl-L-2-amino-6-oxopimelate&&N-Succinyl-2-amino-6-oxo-L-pimelic acid&&N-Succinyl-epsilon-keto-L-aminopimelic acid&&(S)-2-(Succinylamino)-6-oxoheptanedioate&& | + | |Common Name=&&N-Succinyl-2-L-amino-6-oxoheptanedioate&&N-Succinyl-L-2-amino-6-oxoheptanedioate&&N-Succinyl-L-2-amino-6-oxopimelate&&N-Succinyl-2-amino-6-oxo-L-pimelic acid&&N-Succinyl-epsilon-keto-L-aminopimelic acid&& (S) -2- (Succinylamino) -6-oxoheptanedioate&& |
|CAS=? | |CAS=? | ||
|KEGG=C04462 | |KEGG=C04462 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C04462 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMFYB7DAj004.mol |
| N-Succinyl-2-L-amino-6-oxoheptanedioate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | N-Succinyl-2-amino-6-oxo-L-pimelic acid |
| Common Name |
|
| Symbol | |
| Formula | C11H15NO8 |
| Exact Mass | 289.0797 |
| Average Mass | 289.2387 |
| SMILES | OC(=O)CCC(=O)N[C@@H](CCCC(=O)C(O)=O)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
