BMFYB6SAk001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=2-Amino-3-carboxy-muconate semialdehyde | |SysName=2-Amino-3-carboxy-muconate semialdehyde | ||
| − | |Common Name=&&2-Amino-3-carboxymuconate semialdehyde&&2-Amino-3-(3-oxoprop-1-enyl)-but-2-enedioate&&2-Amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioate&& | + | |Common Name=&&2-Amino-3-carboxymuconate semialdehyde&&2-Amino-3- (3-oxoprop-1-enyl) -but-2-enedioate&&2-Amino-3- (3-oxoprop-1-en-1-yl) but-2-enedioate&& |
|CAS=? | |CAS=? | ||
|KEGG=C04409 | |KEGG=C04409 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C04409 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMFYB6SAk001.mol |
| 2-Amino-3-carboxymuconate semialdehyde | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2-Amino-3-carboxy-muconate semialdehyde |
| Common Name |
|
| Symbol | |
| Formula | C7H7NO5 |
| Exact Mass | 185.0324 |
| Average Mass | 185.1342 |
| SMILES | O=CC=CC(C(O)=O)=C(N)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
