BMFYB4HOa001
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C05997 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMFYB4HOa001.mol |
| 3-Hydroxyisopentyl-CoA | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3-Hydroxy-isopentyl-CoA |
| Common Name |
|
| Symbol | |
| Formula | C26H44N7O18P3S |
| Exact Mass | 867.1676 |
| Average Mass | 867.6512 |
| SMILES | C([C@H](C(NCCC(NCCSC(CC(C)(C)O)=O)=O)=O)O)(C)(C)CO |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
