BMCCQI--k009
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 79127-57-4 |
| KEGG | C01359 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCQI--k009.mol |
| |
| Structural Information | |
| Systematic Name | PQQH2 |
| Common Name | |
| Symbol | |
| Formula | C14H8N2O8 |
| Exact Mass | 332.028 |
| Average Mass | 332.222 |
| SMILES | OC(=O)c(c3)nc(c31)c(c(C(O)=O)2)c(nc(C(O)=O)c2)c(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
