BMCCPUXA0006
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 890-38-0 |
| KEGG | C05512 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCPUXA0006.mol |
| |
| Structural Information | |
| Systematic Name | Deoxy-inosine |
| Common Name | |
| Symbol | |
| Formula | C10H12N4O4 |
| Exact Mass | 252.0858 |
| Average Mass | 252.2268 |
| SMILES | OC[C@@H](O1)[C@@H](O)C[C@@H]1n(c3)c(N=2)c(n3)C(=O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
