BMCCPUGU0002
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C02507 |
KNApSAcK | |
CDX file | |
MOL file | BMCCPUGU0002.mol |
3',5'-Cyclic dGMP | |
---|---|
Structural Information | |
Systematic Name | 3',5'-Cyclic dGMP |
Common Name |
|
Symbol | |
Formula | C10H12N5O6P |
Exact Mass | 329.0525 |
Average Mass | 329.2061 |
SMILES | NC(N4)=Nc(c3C(=O)4)n(cn3)[C@H](O1)C[C@H](O2)[C@@H] |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |