BMCCPUAPq005
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=3-(ADP)-glyceric acid | + | |SysName=3- (ADP) -glyceric acid |
| − | |Common Name=&&3-(ADP)-glycerate&& | + | |Common Name=&&3- (ADP) -glycerate&& |
|CAS=? | |CAS=? | ||
|KEGG=C02509 | |KEGG=C02509 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C02509 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCPUAPq005.mol |
| 3- (ADP) -glycerate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3- (ADP) -glyceric acid |
| Common Name |
|
| Symbol | |
| Formula | C13H19N5O13P2 |
| Exact Mass | 515.0454 |
| Average Mass | 515.2633 |
| SMILES | OC(=O)C(O)COP(O)(=O)OP(O)(=O)OC[C@@H](O1)[C@@H](O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
