BMCCPUADr001
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 5142-22-3 |
KEGG | C02216 |
KNApSAcK | |
CDX file | |
MOL file | BMCCPUADr001.mol |
1-Methyladenine | |
---|---|
Structural Information | |
Systematic Name | 1-Methyl-adenine |
Common Name |
|
Symbol | |
Formula | C6H7N5 |
Exact Mass | 149.0701 |
Average Mass | 149.1534 |
SMILES | CN(C=1)C(=N)c(n2)c(nc2)N1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |