BMCCPUADq017
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=Zeatin | |SysName=Zeatin | ||
| − | |Common Name=&&Zeatin&&N6-(4-Hydroxyisopentenyl)adenine&&(E)-2-Methyl-4-(1H-purin-6-ylamino)but-2-en-1-ol&& | + | |Common Name=&&Zeatin&&N6- (4-Hydroxyisopentenyl) adenine&& (E) -2-Methyl-4- (1H-purin-6-ylamino) but-2-en-1-ol&& |
|CAS=1637-39-4 | |CAS=1637-39-4 | ||
|KEGG=C00371 | |KEGG=C00371 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 1637-39-4 |
| KEGG | C00371 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCPUADq017.mol |
| Zeatin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Zeatin |
| Common Name |
|
| Symbol | |
| Formula | C10H13N5O |
| Exact Mass | 219.112 |
| Average Mass | 219.2433 |
| SMILES | OCC(C)=CCNc(n2)c(n1)c(nc2)nc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
