BMCCID--m034
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=Serotonin | |SysName=Serotonin | ||
| − | |Common Name=&&3-(2-Aminoethyl)-1H-indol-5-ol&&Serotonin&&5-Hydroxytryptamine&& | + | |Common Name=&&3- (2-Aminoethyl) -1H-indol-5-ol&&Serotonin&&5-Hydroxytryptamine&& |
|CAS=50-67-9 | |CAS=50-67-9 | ||
|KEGG=C00780 | |KEGG=C00780 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 50-67-9 |
| KEGG | C00780 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCID--m034.mol |
| 3- (2-Aminoethyl) -1H-indol-5-ol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Serotonin |
| Common Name |
|
| Symbol | |
| Formula | C10H12N2O |
| Exact Mass | 176.0949 |
| Average Mass | 176.2151 |
| SMILES | NCCc(c1)c(c2)c(ccc(O)2)n1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
