BMCCID--k023
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 87-51-4 |
KEGG | C00954 |
KNApSAcK | |
CDX file | |
MOL file | BMCCID--k023.mol |
Indole-3-acetate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Indole-3-acetic acid |
Common Name |
|
Symbol | |
Formula | C10H9NO2 |
Exact Mass | 175.0633 |
Average Mass | 175.184 |
SMILES | OC(=O)Cc(c1)c(c2)c(ccc2)n1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways