BMAXS6ANk004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=L-Saccharopine | |SysName=L-Saccharopine | ||
| − | |Common Name=&&N6-(L-1,3-Dicarboxypropyl)-L-lysine&&Saccharopine&&L-Saccharopine&& | + | |Common Name=&&N6- (L-1,3-Dicarboxypropyl) -L-lysine&&Saccharopine&&L-Saccharopine&& |
|CAS=997-68-2 | |CAS=997-68-2 | ||
|KEGG=C00449 | |KEGG=C00449 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 997-68-2 |
| KEGG | C00449 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAXS6ANk004.mol |
| N6- (L-1,3-Dicarboxypropyl) -L-lysine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | L-Saccharopine |
| Common Name |
|
| Symbol | |
| Formula | C11H20N2O6 |
| Exact Mass | 276.1321 |
| Average Mass | 276.2863 |
| SMILES | OC(=O)CC[C@H](NCCCC[C@H](N)C(O)=O)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
