BMAXS6AMl001
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 1190-49-4 |
KEGG | C02427 |
KNApSAcK | |
CDX file | |
MOL file | BMAXS6AMl001.mol |
L-Homocitrulline | |
---|---|
![]() | |
Structural Information | |
Systematic Name | L-Homocitrulline |
Common Name |
|
Symbol | |
Formula | C7H15N3O3 |
Exact Mass | 189.1113 |
Average Mass | 189.2124 |
SMILES | NC(=O)NCCCC[C@H](N)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |