BMAXS4CAl002
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 13184-27-5 |
KEGG | C00438 |
KNApSAcK | |
CDX file | |
MOL file | BMAXS4CAl002.mol |
![]() | |
Structural Information | |
Systematic Name | N-Carbamoyl-L-aspartic acid |
Common Name | |
Symbol | |
Formula | C5H8N2O5 |
Exact Mass | 176.0433 |
Average Mass | 176.1275 |
SMILES | NC(=O)N[C@@H](CC(O)=O)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways