BMAXS3AKf007
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 496-65-1 |
KEGG | C00831 |
KNApSAcK | |
CDX file | |
MOL file | BMAXS3AKf007.mol |
Pantetheine | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Pantetheine |
Common Name |
|
Symbol | |
Formula | C11H22N2O4S |
Exact Mass | 278.13 |
Average Mass | 278.3694 |
SMILES | SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways