BMAXDP--0018
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 1160-54-9 |
KEGG | C01632 |
KNApSAcK | |
CDX file | |
MOL file | BMAXDP--0018.mol |
Z-Gly-Pro | |
---|---|
Structural Information | |
Systematic Name | Z-Gly-Pro |
Common Name |
|
Symbol | |
Formula | C15H18N2O5 |
Exact Mass | 306.1215 |
Average Mass | 306.3139 |
SMILES | O=C(OCc(c2)cccc2)NCC(=O)N(C1)C(CC1)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |