BMAXDP--0013
From Metabolomics.JP
(Difference between revisions)
| Line 2: | Line 2: | ||
|SysName=L-Cysteinyl-D-valine | |SysName=L-Cysteinyl-D-valine | ||
|Common Name=&& | |Common Name=&& | ||
| − | |CAS= | + | |CAS=32468-23-8 |
|KEGG=D00124 | |KEGG=D00124 | ||
}} | }} | ||
Revision as of 09:00, 14 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 32468-23-8 |
| KEGG | D00124 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAXDP--0013.mol |
| |
| Structural Information | |
| Systematic Name | L-Cysteinyl-D-valine |
| Common Name | |
| Symbol | |
| Formula | C8H16N2O3S |
| Exact Mass | 220.0881 |
| Average Mass | 220.2903 |
| SMILES | CC(C)[C@H](C(O)=O)NC(=O)[C@@H](N)CS |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
