BMAXDP--0012
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=L-Carnosine | |SysName=L-Carnosine | ||
| − | |Common Name=&&Carnosine&&Nalpha-(beta-alanyl)-L-histidine&& | + | |Common Name=&&Carnosine&&Nalpha- (beta-alanyl) -L-histidine&& |
|CAS=305-84-0 | |CAS=305-84-0 | ||
|KEGG=C00386 | |KEGG=C00386 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 305-84-0 |
| KEGG | C00386 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAXDP--0012.mol |
| Carnosine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | L-Carnosine |
| Common Name |
|
| Symbol | |
| Formula | C9H14N4O3 |
| Exact Mass | 226.1065 |
| Average Mass | 226.2326 |
| SMILES | NCCC(=O)N[C@@H](Cc(c1)ncn1)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
