BMAXDP--0003
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C05340 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAXDP--0003.mol |
| beta-Alanyl-L-arginine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | beta-Alanyl-L-arginine |
| Common Name |
|
| Symbol | |
| Formula | C9H19N5O3 |
| Exact Mass | 245.1487 |
| Average Mass | 245.279 |
| SMILES | NCCC(=O)N[C@@H](CCCNC(N)=N)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
