BMAXB5AMr001
From Metabolomics.JP
(Difference between revisions)
| Line 2: | Line 2: | ||
|SysName=4-Methylene-L-glutamine | |SysName=4-Methylene-L-glutamine | ||
|Common Name=&&4-Methylene-L-glutamine&& | |Common Name=&&4-Methylene-L-glutamine&& | ||
| − | |CAS= | + | |CAS=31138-12-2 |
|KEGG=C01109 | |KEGG=C01109 | ||
}} | }} | ||
Revision as of 09:00, 14 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 31138-12-2 |
| KEGG | C01109 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAXB5AMr001.mol |
| 4-Methylene-L-glutamine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4-Methylene-L-glutamine |
| Common Name |
|
| Symbol | |
| Formula | C6H10N2O3 |
| Exact Mass | 158.0691 |
| Average Mass | 158.1552 |
| SMILES | C=C(C[C@H](N)C(O)=O)C(N)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
