BMACIDCAm002
From Metabolomics.JP
(Difference between revisions)
m (BMAXCCIDk002 moved to BMACIDCAm002) |
Revision as of 13:05, 8 September 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C04692 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMACIDCAm002.mol |
| 2- [ 3-Carboxy-3- (methylammonio) propyl ] -L-histidine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- [ 3-Carboxy-3- (methyl-ammonio) -propyl ] -L-histidine |
| Common Name |
|
| Symbol | |
| Formula | C11H19N4O4 |
| Exact Mass | 271.1406 |
| Average Mass | 271.2931 |
| SMILES | C[NH2+1]C(CC[C@](N)(C(O)=O)Cc(c1)ncn1)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
