BMACBZ--i010
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 2018-61-3 |
KEGG | C03519 |
KNApSAcK | |
CDX file | |
MOL file | BMACBZ--i010.mol |
N-Acetyl-L-phenylalanine | |
---|---|
![]() | |
Structural Information | |
Systematic Name | N-Acetyl-L-phenylalanine |
Common Name |
|
Symbol | |
Formula | C11H13NO3 |
Exact Mass | 207.0895 |
Average Mass | 207.2258 |
SMILES | CC(=O)N[C@H](C(O)=O)Cc(c1)cccc1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways