BMAAS4PH0001
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C03082 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAAS4PH0001.mol |
| 4-Phospho-L-aspartate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | L-4-phospho-aspartic acid |
| Common Name |
|
| Symbol | |
| Formula | C4H8NO7P |
| Exact Mass | 213.0038 |
| Average Mass | 213.0826 |
| SMILES | N[C@@H](CC(=O)OP(O)(O)=O)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
