Atropine
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=alpha-(Hydroxymethyl)-benzeneacetic acid (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester |Common Name=&&Atropine&&Hyoscyamine&&Atropin...) |
Latest revision as of 11:52, 4 January 2010
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 51-55-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Atropine.mol |
| Atropine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | alpha-(Hydroxymethyl)-benzeneacetic acid (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester |
| Common Name |
|
| Symbol | |
| Formula | C17H23NO3 |
| Exact Mass | 289.167793607 |
| Average Mass | 289.36946 |
| SMILES | OCC(C(=O)OC(C2)CC(C3)N(C)C(C3)2)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
