Atropine
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=alpha-(Hydroxymethyl)-benzeneacetic acid (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester |Common Name=&&Atropine&&Hyoscyamine&&Atropin...) |
Latest revision as of 11:52, 4 January 2010
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 51-55-8 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Atropine.mol |
Atropine | |
---|---|
![]() | |
Structural Information | |
Systematic Name | alpha-(Hydroxymethyl)-benzeneacetic acid (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester |
Common Name |
|
Symbol | |
Formula | C17H23NO3 |
Exact Mass | 289.167793607 |
Average Mass | 289.36946 |
SMILES | OCC(C(=O)OC(C2)CC(C3)N(C)C(C3)2)c(c1)cccc1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |