Alkannin
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=5,8-Dihydroxy-2-[(1S)-1-hydroxy-4-methyl-3-penten-1-yl]-1,4-naphthalenedione |Common Name=&&(S)-5,8-Dihydroxy-2-(1-hydroxy-4-methyl-3-pent...) |
Revision as of 10:01, 11 December 2009
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 517-88-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Alkannin.mol |
(S)-5,8-Dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-1,4-naphthalenedione | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 5,8-Dihydroxy-2-[(1S)-1-hydroxy-4-methyl-3-penten-1-yl]-1,4-naphthalenedione |
Common Name |
|
Symbol | |
Formula | C16H16O5 |
Exact Mass | 288.099773622 |
Average Mass | 288.29524 |
SMILES | CC(C)=CCC(O)c(c1)c(=O)c(c(O)2)c(c(O)cc2)c(=O)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |