Aconitine
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=(1.alpha.,3.alpha.,6.alpha.,14.alpha.,15.alpha.,16.beta.)-20-ethyl-1,6,16-trimethoxy-4-(methoxymethyl)-Aconitane-3,8,13,14,15-pentol 8-ace...) |
Revision as of 18:32, 14 December 2009
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 302-27-2 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Aconitine.mol |
Aconitine | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (1.alpha.,3.alpha.,6.alpha.,14.alpha.,15.alpha.,16.beta.)-20-ethyl-1,6,16-trimethoxy-4-(methoxymethyl)-Aconitane-3,8,13,14,15-pentol 8-acetate 14-benzoate, |
Common Name |
|
Symbol | |
Formula | C34H47NO11 |
Exact Mass | 645.314911351 |
Average Mass | 645.73712 |
SMILES | OC(C6OC)(C1)C(OC(=O)c(c7)cccc7)C(C(OC(C)=O)(C6O)2) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |