(E)-Ferulic acid
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=3-(4-hydroxy-3-methoxyphenyl)-, 2-Propenoic acid |Common Name=&&4-hydroxy-3-methoxy-, Cinnamic acid&&3-(4-Hydroxy-3-methoxyphenyl)-2-prop...) |
Latest revision as of 16:19, 11 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 1135-24-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | (E)-Ferulic acid.mol |
| 4-hydroxy-3-methoxy-, Cinnamic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3-(4-hydroxy-3-methoxyphenyl)-, 2-Propenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C10H10O4 |
| Exact Mass | 194.05790880799998 |
| Average Mass | 194.184 |
| SMILES | COc(c1)c(O)ccc(C=CC(O)=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
