Phyllodulcin
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName= |Common Name=&&&& |CAS=21499-23-0 |KNApSAcK= }}) |
Revision as of 15:13, 5 December 2009
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 21499-23-0 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Phyllodulcin.mol |
![]() | |
Structural Information | |
Systematic Name | |
Common Name | |
Symbol | |
Formula | C16H14O5 |
Exact Mass | 286.084123558 |
Average Mass | 286.27936 |
SMILES | COc(c3)c(O)cc(c3)C(O1)Cc(c2)c(c(O)cc2)C(=O)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |