Osthole
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=7-Methoxy-8-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-2-one |Common Name=&&7-Methoxy-8-(3-methyl-2-butenyl)-2H-1-benzopyran-2-one&&7-Methoxy...) |
|||
| Line 3: | Line 3: | ||
{{Metabolite | {{Metabolite | ||
|SysName=7-Methoxy-8-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-2-one | |SysName=7-Methoxy-8-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-2-one | ||
| − | |Common Name=&&7-Methoxy-8-(3-methyl-2-butenyl)-2H-1-benzopyran-2-one&&7-Methoxy-8-(3-methyl-2-butenyl)-coumarin&&Osthole&&7-Methoxy-8-(3-methyl-2-butenyl)coumarin&&7-Methoxy-8-isopentenylcoumarin&&8-(3-Methyl-2-butenyl)herniarin | + | |Common Name=&&Osthol&&7-Methoxy-8-(3-methyl-2-butenyl)-2H-1-benzopyran-2-one&&7-Methoxy-8-(3-methyl-2-butenyl)-coumarin&&Osthole&&7-Methoxy-8-(3-methyl-2-butenyl)coumarin&&7-Methoxy-8-isopentenylcoumarin&&8-(3-Methyl-2-butenyl)herniarin&&Ostol&&Ostole&& |
|CAS=484-12-8 | |CAS=484-12-8 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
Latest revision as of 14:19, 12 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 484-12-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Osthole.mol |
| Osthol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Methoxy-8-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-2-one |
| Common Name |
|
| Symbol | |
| Formula | C15H16O3 |
| Exact Mass | 244.109944378 |
| Average Mass | 244.28574 |
| SMILES | CC(C)=CCc(c(OC)1)c(O2)c(C=CC(=O)2)cc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
