LBF24603SC01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0225 | |LipidBank=DFA0225 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0225 |
| LipidMaps | LMFA01030186 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF24603SC01.mol |
| |
| Structural Information | |
| Systematic Name | 4, 8, 12, 15, 19, 21-Tetracosahexaenoic acid |
| Common Name | |
| Symbol | |
| Formula | C24H36O2 |
| Exact Mass | 356.271530396 |
| Average Mass | 356.54144 |
| SMILES | C(C=CCCC(O)=O)CC=CCCC=CCC=CCC=CCC=CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | 0.9452 at 20 °C |
| Optical Rotation | 1.5122 at 20 °C |
| Reflactive Index | |
| Solubility | soluble in benzene, chloroform, methyl alcohol, ether and petroleum ether.<<0004>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
