LBF24603SC01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA0225 |
LipidMaps | LMFA01030186 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF24603SC01.mol |
![]() | |
Structural Information | |
Systematic Name | 4, 8, 12, 15, 19, 21-Tetracosahexaenoic acid |
Common Name | |
Symbol | |
Formula | C24H36O2 |
Exact Mass | 356.271530396 |
Average Mass | 356.54144 |
SMILES | C(C=CCCC(O)=O)CC=CCCC=CCC=CCC=CCC=CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | 0.9452 at 20 °C |
Optical Rotation | 1.5122 at 20 °C |
Reflactive Index | |
Solubility | soluble in benzene, chloroform, methyl alcohol, ether and petroleum ether.<<0004>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |