LBF23000BC02
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0247 |
| LipidMaps | LMFA01020022 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF23000BC02.mol |
| |
| Structural Information | |
| Systematic Name | 3, 13, 19-Trimethyltricosanoic acid |
| Common Name | |
| Symbol | |
| Formula | C26H52O2 |
| Exact Mass | 396.396730908 |
| Average Mass | 396.68987999999996 |
| SMILES | CCCCC(C)CCCCCC(C)CCCCCCCCCC(C)CC(O)=O |
| Physicochemical Information | |
| Melting Point | -8°C |
| Boiling Point | 208°C at 760mmHg |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | <<0111>><<0112>><<0395>><<0457>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
