LBF22406SC01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0217 |
| LipidMaps | LMFA01030178 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF22406SC01.mol |
| |
| Structural Information | |
| Systematic Name | 7, 10, 13, 16-Docosatetraenoic acid |
| Common Name | |
| Symbol | |
| Formula | C22H36O2 |
| Exact Mass | 332.271530396 |
| Average Mass | 332.52004000000005 |
| SMILES | C(CCC(O)=O)CCC=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in carbon disulfide, heptane and methyl alcohol.<<0292>><<0294>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
