LBF22308SC01
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 30 September 2008
IDs and Links | |
---|---|
LipidBank | DFA0201 |
LipidMaps | LMFA01030162 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF22308SC01.mol |
Structural Information | |
---|---|
Systematic Name | 8, 11, 14-Docosatriennoic acid |
Common Name | |
Symbol | |
Formula | C22H38O2 |
Exact Mass | 334.28718046 |
Average Mass | 334.53592000000003 |
SMILES | C(CCC(O)=O)CCCC=CCC=CCC=CCCCCCCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | <<0293>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |