LBF22109SC02
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0129 | |LipidBank=DFA0129 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0129 |
| LipidMaps | LMFA01030090 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF22109SC02.mol |
| trans-Brassidic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | trans-13-Docosenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C22H42O2 |
| Exact Mass | 338.318480588 |
| Average Mass | 338.56768000000005 |
| SMILES | C(CCC(O)=O)CCCCCCCCC=CCCCCCCCC |
| Physicochemical Information | |
| Melting Point | 61.9°C |
| Boiling Point | 265°C at 15 mmHg |
| Density | dX470 0.85002 |
| Optical Rotation | 1.44349 at 70°C |
| Reflactive Index | |
| Solubility | sparingly solbule in cold ethanol <<0091>> <<0096>> <<0097>> <<0550>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
